C11H23N — CID 160816755
1-azabicyclo[2.2.1]heptane;2,2-dimethylpropane (PubChem CID 160816755) has the molecular formula C11H23N and a molecular weight of 169.31 g/mol. Its IUPAC name is 1-azabicyclo[2.2.1]heptane;2,2-dimethylpropane.
| Compound Name | 1-azabicyclo[2.2.1]heptane;2,2-dimethylpropane |
|---|---|
| PubChem CID | 160816755 |
| Molecular Formula | C11H23N |
| Molecular Weight | 169.31 g/mol |
| Exact Mass | 169.18 |
| IUPAC Name | 1-azabicyclo[2.2.1]heptane;2,2-dimethylpropane |
| SMILES | C1CN2CCC1C2.CC(C)(C)C |
| InChI | InChI=1S/C6H11N.C5H12/c1-3-7-4-2-6(1)5-7;1-5(2,3)4/h6H,1-5H2;1-4H3 |
| InChIKey | SEZSHGUWLFBGAC-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.31 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |