About 1-azabicyclo[2.2.1]heptane;2-oxaspiro[3.3]heptane
1-azabicyclo[2.2.1]heptane;2-oxaspiro[3.3]heptane (PubChem CID 167660242) has the molecular formula C12H21NO
and a molecular weight of 195.31 g/mol. Its IUPAC name is 1-azabicyclo[2.2.1]heptane;2-oxaspiro[3.3]heptane.
Molecular Properties
| Compound Name | 1-azabicyclo[2.2.1]heptane;2-oxaspiro[3.3]heptane |
| PubChem CID | 167660242 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 1-azabicyclo[2.2.1]heptane;2-oxaspiro[3.3]heptane |
| SMILES | C1CC2(C1)COC2.C1CN2CCC1C2 |
| InChI | InChI=1S/C6H11N.C6H10O/c1-3-7-4-2-6(1)5-7;1-2-6(3-1)4-7-5-6/h6H,1-5H2;1-5H2 |
| InChIKey | RVRXTRCAQDERGP-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-azabicyclo[2.2.1]heptane;2-oxaspiro[3.3]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azabicyclo[2.2.1]heptane;2-oxaspiro[3.3]heptane?
The IUPAC name of 1-azabicyclo[2.2.1]heptane;2-oxaspiro[3.3]heptane (CID 167660242) is 1-azabicyclo[2.2.1]heptane;2-oxaspiro[3.3]heptane.
What is the SMILES notation for 1-azabicyclo[2.2.1]heptane;2-oxaspiro[3.3]heptane?
The canonical SMILES for 1-azabicyclo[2.2.1]heptane;2-oxaspiro[3.3]heptane is C1CC2(C1)COC2.C1CN2CCC1C2.
What is the InChIKey of 1-azabicyclo[2.2.1]heptane;2-oxaspiro[3.3]heptane?
The InChIKey is RVRXTRCAQDERGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N.C6H10O/c1-3-7-4-2-6(1)5-7;1-2-6(3-1)4-7-5-6/h6H,1-5H2;1-5H2.
What are the key properties of 1-azabicyclo[2.2.1]heptane;2-oxaspiro[3.3]heptane?
1-azabicyclo[2.2.1]heptane;2-oxaspiro[3.3]heptane has a molecular weight of 195.31 g/mol, XLogP of 1.90, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azabicyclo[2.2.1]heptane;2-oxaspiro[3.3]heptane is sourced from PubChem (CID 167660242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).