C12H21N — CID 54001237
10-azatricyclo[8.2.1.03,7]tridecane (PubChem CID 54001237) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is 10-azatricyclo[8.2.1.03,7]tridecane.
| Compound Name | 10-azatricyclo[8.2.1.03,7]tridecane |
|---|---|
| PubChem CID | 54001237 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | 10-azatricyclo[8.2.1.03,7]tridecane |
| SMILES | C1CC2CCN3CCC(CC2C1)C3 |
| InChI | InChI=1S/C12H21N/c1-2-11-5-7-13-6-4-10(9-13)8-12(11)3-1/h10-12H,1-9H2 |
| InChIKey | KLTRVZHOYXWIBI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |