C13H22 — CID 54121059
(3R,11S)-tricyclo[5.5.1.03,11]tridecane (PubChem CID 54121059) has the molecular formula C13H22 and a molecular weight of 178.32 g/mol. Its IUPAC name is (3R,11S)-tricyclo[5.5.1.03,11]tridecane.
| Compound Name | (3R,11S)-tricyclo[5.5.1.03,11]tridecane |
|---|---|
| PubChem CID | 54121059 |
| Molecular Formula | C13H22 |
| Molecular Weight | 178.32 g/mol |
| Exact Mass | 178.17 |
| IUPAC Name | (3R,11S)-tricyclo[5.5.1.03,11]tridecane |
| SMILES | C1CC2CCC[C@H]3CC(C2)C[C@H]3C1 |
| InChI | InChI=1S/C13H22/c1-3-10-4-2-6-13-9-11(7-10)8-12(13)5-1/h10-13H,1-9H2/t10?,11?,12-,13+ |
| InChIKey | NNSNPSIRKCWPSQ-BPNZPQAUSA-N |
| XLogP | 4.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.32 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |