About bicyclo[3.1.1]heptane;bicyclo[4.1.0]heptane;ethane;propane
bicyclo[3.1.1]heptane;bicyclo[4.1.0]heptane;ethane;propane (PubChem CID 90909345) has the molecular formula C21H44
and a molecular weight of 296.58 g/mol. Its IUPAC name is bicyclo[3.1.1]heptane;bicyclo[4.1.0]heptane;ethane;propane.
Molecular Properties
| Compound Name | bicyclo[3.1.1]heptane;bicyclo[4.1.0]heptane;ethane;propane |
| PubChem CID | 90909345 |
| Molecular Formula | C21H44 |
| Molecular Weight | 296.58 g/mol |
| Exact Mass | 296.34 |
| IUPAC Name | bicyclo[3.1.1]heptane;bicyclo[4.1.0]heptane;ethane;propane |
| SMILES | C1CC2CC(C1)C2.C1CCC2CC2C1.CC.CC.CCC |
| InChI | InChI=1S/2C7H12.C3H8.2C2H6/c1-2-6-4-7(3-1)5-6;1-2-4-7-5-6(7)3-1;1-3-2;2*1-2/h2*6-7H,1-5H2;3H2,1-2H3;2*1-2H3 |
| InChIKey | DVLVNHZXBJQOBT-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 296.58 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze bicyclo[3.1.1]heptane;bicyclo[4.1.0]heptane;ethane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[3.1.1]heptane;bicyclo[4.1.0]heptane;ethane;propane?
The IUPAC name of bicyclo[3.1.1]heptane;bicyclo[4.1.0]heptane;ethane;propane (CID 90909345) is bicyclo[3.1.1]heptane;bicyclo[4.1.0]heptane;ethane;propane.
What is the SMILES notation for bicyclo[3.1.1]heptane;bicyclo[4.1.0]heptane;ethane;propane?
The canonical SMILES for bicyclo[3.1.1]heptane;bicyclo[4.1.0]heptane;ethane;propane is C1CC2CC(C1)C2.C1CCC2CC2C1.CC.CC.CCC.
What is the InChIKey of bicyclo[3.1.1]heptane;bicyclo[4.1.0]heptane;ethane;propane?
The InChIKey is DVLVNHZXBJQOBT-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H12.C3H8.2C2H6/c1-2-6-4-7(3-1)5-6;1-2-4-7-5-6(7)3-1;1-3-2;2*1-2/h2*6-7H,1-5H2;3H2,1-2H3;2*1-2H3.
What are the key properties of bicyclo[3.1.1]heptane;bicyclo[4.1.0]heptane;ethane;propane?
bicyclo[3.1.1]heptane;bicyclo[4.1.0]heptane;ethane;propane has a molecular weight of 296.58 g/mol, XLogP of 7.86, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[3.1.1]heptane;bicyclo[4.1.0]heptane;ethane;propane is sourced from PubChem (CID 90909345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).