About (1S,6R)-bicyclo[4.3.1]decane
(1S,6R)-bicyclo[4.3.1]decane (PubChem CID 58154231) has the molecular formula C10H18
and a molecular weight of 138.25 g/mol. Its IUPAC name is (1S,6R)-bicyclo[4.3.1]decane.
Molecular Properties
| Compound Name | (1S,6R)-bicyclo[4.3.1]decane |
| PubChem CID | 58154231 |
| Molecular Formula | C10H18 |
| Molecular Weight | 138.25 g/mol |
| Exact Mass | 138.14 |
| IUPAC Name | (1S,6R)-bicyclo[4.3.1]decane |
| SMILES | C1CC[C@H]2CCC[C@@H](C1)C2 |
| InChI | InChI=1S/C10H18/c1-2-5-10-7-3-6-9(4-1)8-10/h9-10H,1-8H2/t9-,10+ |
| InChIKey | QEGGPUAKCVWNOT-AOOOYVTPSA-N |
| XLogP | 3.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.25 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (1S,6R)-bicyclo[4.3.1]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,6R)-bicyclo[4.3.1]decane?
The IUPAC name of (1S,6R)-bicyclo[4.3.1]decane (CID 58154231) is (1S,6R)-bicyclo[4.3.1]decane.
What is the SMILES notation for (1S,6R)-bicyclo[4.3.1]decane?
The canonical SMILES for (1S,6R)-bicyclo[4.3.1]decane is C1CC[C@H]2CCC[C@@H](C1)C2.
What is the InChIKey of (1S,6R)-bicyclo[4.3.1]decane?
The InChIKey is QEGGPUAKCVWNOT-AOOOYVTPSA-N. The full InChI is InChI=1S/C10H18/c1-2-5-10-7-3-6-9(4-1)8-10/h9-10H,1-8H2/t9-,10+.
What are the key properties of (1S,6R)-bicyclo[4.3.1]decane?
(1S,6R)-bicyclo[4.3.1]decane has a molecular weight of 138.25 g/mol, XLogP of 3.37, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,6R)-bicyclo[4.3.1]decane is sourced from PubChem (CID 58154231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).