C10H18 — CID 58154231
(1S,6R)-bicyclo[4.3.1]decane (PubChem CID 58154231) has the molecular formula C10H18 and a molecular weight of 138.25 g/mol. Its IUPAC name is (1S,6R)-bicyclo[4.3.1]decane.
| Compound Name | (1S,6R)-bicyclo[4.3.1]decane |
|---|---|
| PubChem CID | 58154231 |
| Molecular Formula | C10H18 |
| Molecular Weight | 138.25 g/mol |
| Exact Mass | 138.14 |
| IUPAC Name | (1S,6R)-bicyclo[4.3.1]decane |
| SMILES | C1CC[C@H]2CCC[C@@H](C1)C2 |
| InChI | InChI=1S/C10H18/c1-2-5-10-7-3-6-9(4-1)8-10/h9-10H,1-8H2/t9-,10+ |
| InChIKey | QEGGPUAKCVWNOT-AOOOYVTPSA-N |
| XLogP | 3.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.25 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |