C15H28 — CID 59938678
bicyclo[5.5.3]pentadecane (PubChem CID 59938678) has the molecular formula C15H28 and a molecular weight of 208.39 g/mol. Its IUPAC name is bicyclo[5.5.3]pentadecane.
| Compound Name | bicyclo[5.5.3]pentadecane |
|---|---|
| PubChem CID | 59938678 |
| Molecular Formula | C15H28 |
| Molecular Weight | 208.39 g/mol |
| Exact Mass | 208.22 |
| IUPAC Name | bicyclo[5.5.3]pentadecane |
| SMILES | C1CCC2CCCCCC(CC1)CCC2 |
| InChI | InChI=1S/C15H28/c1-3-8-14-10-5-2-6-11-15(9-4-1)13-7-12-14/h14-15H,1-13H2 |
| InChIKey | MTUUHWDRIAQFGQ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.39 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |