C11H20 — CID 14399147
bicyclo[5.3.1]undecane (PubChem CID 14399147) has the molecular formula C11H20 and a molecular weight of 152.28 g/mol. Its IUPAC name is bicyclo[5.3.1]undecane.
| Compound Name | bicyclo[5.3.1]undecane |
|---|---|
| PubChem CID | 14399147 |
| Molecular Formula | C11H20 |
| Molecular Weight | 152.28 g/mol |
| Exact Mass | 152.16 |
| IUPAC Name | bicyclo[5.3.1]undecane |
| SMILES | C1CCC2CCCC(CC1)C2 |
| InChI | InChI=1S/C11H20/c1-2-5-10-7-4-8-11(9-10)6-3-1/h10-11H,1-9H2 |
| InChIKey | BAJIUXJJEOUUDP-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.28 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |