C11H22 — CID 165048741
methane;(2S)-2-methylbicyclo[3.3.1]nonane (PubChem CID 165048741) has the molecular formula C11H22 and a molecular weight of 154.30 g/mol. Its IUPAC name is methane;(2S)-2-methylbicyclo[3.3.1]nonane.
| Compound Name | methane;(2S)-2-methylbicyclo[3.3.1]nonane |
|---|---|
| PubChem CID | 165048741 |
| Molecular Formula | C11H22 |
| Molecular Weight | 154.30 g/mol |
| Exact Mass | 154.17 |
| IUPAC Name | methane;(2S)-2-methylbicyclo[3.3.1]nonane |
| SMILES | C.C[C@H]1CCC2CCCC1C2 |
| InChI | InChI=1S/C10H18.CH4/c1-8-5-6-9-3-2-4-10(8)7-9;/h8-10H,2-7H2,1H3;1H4/t8-,9?,10?;/m0./s1 |
| InChIKey | PHZPZGMPKSRAOJ-AYUROHKDSA-N |
| XLogP | 3.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.30 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |