C10H20 — CID 159184237
ethane;(1R,2R,4R)-2-methylbicyclo[2.2.1]heptane (PubChem CID 159184237) has the molecular formula C10H20 and a molecular weight of 140.27 g/mol. Its IUPAC name is ethane;(1R,2R,4R)-2-methylbicyclo[2.2.1]heptane.
| Compound Name | ethane;(1R,2R,4R)-2-methylbicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 159184237 |
| Molecular Formula | C10H20 |
| Molecular Weight | 140.27 g/mol |
| Exact Mass | 140.16 |
| IUPAC Name | ethane;(1R,2R,4R)-2-methylbicyclo[2.2.1]heptane |
| SMILES | CC.C[C@@H]1C[C@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C8H14.C2H6/c1-6-4-7-2-3-8(6)5-7;1-2/h6-8H,2-5H2,1H3;1-2H3/t6-,7-,8-;/m1./s1 |
| InChIKey | KNGXYIGSKHPHJL-QTPPMTSNSA-N |
| XLogP | 3.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.27 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |