C14H24 — CID 59550450
4,5-dimethyltricyclo[6.2.1.13,6]dodecane (PubChem CID 59550450) has the molecular formula C14H24 and a molecular weight of 192.35 g/mol. Its IUPAC name is 4,5-dimethyltricyclo[6.2.1.13,6]dodecane.
| Compound Name | 4,5-dimethyltricyclo[6.2.1.13,6]dodecane |
|---|---|
| PubChem CID | 59550450 |
| Molecular Formula | C14H24 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.19 |
| IUPAC Name | 4,5-dimethyltricyclo[6.2.1.13,6]dodecane |
| SMILES | CC1C2CC3CCC(C3)CC(C2)C1C |
| InChI | InChI=1S/C14H24/c1-9-10(2)14-7-12-4-3-11(5-12)6-13(9)8-14/h9-14H,3-8H2,1-2H3 |
| InChIKey | LBVMKYMVWQVACI-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |