C11H22O — CID 123361313
2,3-dimethylbicyclo[2.2.1]heptane;methoxymethane (PubChem CID 123361313) has the molecular formula C11H22O and a molecular weight of 170.30 g/mol. Its IUPAC name is 2,3-dimethylbicyclo[2.2.1]heptane;methoxymethane.
| Compound Name | 2,3-dimethylbicyclo[2.2.1]heptane;methoxymethane |
|---|---|
| PubChem CID | 123361313 |
| Molecular Formula | C11H22O |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.17 |
| IUPAC Name | 2,3-dimethylbicyclo[2.2.1]heptane;methoxymethane |
| SMILES | CC1C2CCC(C2)C1C.COC |
| InChI | InChI=1S/C9H16.C2H6O/c1-6-7(2)9-4-3-8(6)5-9;1-3-2/h6-9H,3-5H2,1-2H3;1-2H3 |
| InChIKey | QGSVIIXSGZPCFB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |