C23H44 — CID 158423545
ethane;2-methyladamantane;2-methylbicyclo[2.2.1]heptane (PubChem CID 158423545) has the molecular formula C23H44 and a molecular weight of 320.61 g/mol. Its IUPAC name is ethane;2-methyladamantane;2-methylbicyclo[2.2.1]heptane.
| Compound Name | ethane;2-methyladamantane;2-methylbicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 158423545 |
| Molecular Formula | C23H44 |
| Molecular Weight | 320.61 g/mol |
| Exact Mass | 320.34 |
| IUPAC Name | ethane;2-methyladamantane;2-methylbicyclo[2.2.1]heptane |
| SMILES | CC.CC.CC1C2CC3CC(C2)CC1C3.CC1CC2CCC1C2 |
| InChI | InChI=1S/C11H18.C8H14.2C2H6/c1-7-10-3-8-2-9(5-10)6-11(7)4-8;1-6-4-7-2-3-8(6)5-7;2*1-2/h7-11H,2-6H2,1H3;6-8H,2-5H2,1H3;2*1-2H3 |
| InChIKey | HATUPZKBBXKBDU-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.61 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |