C11H22 — CID 144841146
(2R,3S)-2,3-dimethylbicyclo[3.1.1]heptane;ethane (PubChem CID 144841146) has the molecular formula C11H22 and a molecular weight of 154.30 g/mol. Its IUPAC name is (2R,3S)-2,3-dimethylbicyclo[3.1.1]heptane;ethane.
| Compound Name | (2R,3S)-2,3-dimethylbicyclo[3.1.1]heptane;ethane |
|---|---|
| PubChem CID | 144841146 |
| Molecular Formula | C11H22 |
| Molecular Weight | 154.30 g/mol |
| Exact Mass | 154.17 |
| IUPAC Name | (2R,3S)-2,3-dimethylbicyclo[3.1.1]heptane;ethane |
| SMILES | CC.C[C@H]1CC2CC(C2)[C@@H]1C |
| InChI | InChI=1S/C9H16.C2H6/c1-6-3-8-4-9(5-8)7(6)2;1-2/h6-9H,3-5H2,1-2H3;1-2H3/t6-,7+,8?,9?;/m0./s1 |
| InChIKey | DLRBEUQCFAGQDC-KSUSIZLGSA-N |
| XLogP | 3.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.30 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |