About methoxyethane;2-methyladamantane
methoxyethane;2-methyladamantane (PubChem CID 174817324) has the molecular formula C14H26O
and a molecular weight of 210.36 g/mol. Its IUPAC name is methoxyethane;2-methyladamantane.
Molecular Properties
| Compound Name | methoxyethane;2-methyladamantane |
| PubChem CID | 174817324 |
| Molecular Formula | C14H26O |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.20 |
| IUPAC Name | methoxyethane;2-methyladamantane |
| SMILES | CC1C2CC3CC(C2)CC1C3.CCOC |
| InChI | InChI=1S/C11H18.C3H8O/c1-7-10-3-8-2-9(5-10)6-11(7)4-8;1-3-4-2/h7-11H,2-6H2,1H3;3H2,1-2H3 |
| InChIKey | XKQHYINZYMKUTR-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze methoxyethane;2-methyladamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxyethane;2-methyladamantane?
The IUPAC name of methoxyethane;2-methyladamantane (CID 174817324) is methoxyethane;2-methyladamantane.
What is the SMILES notation for methoxyethane;2-methyladamantane?
The canonical SMILES for methoxyethane;2-methyladamantane is CC1C2CC3CC(C2)CC1C3.CCOC.
What is the InChIKey of methoxyethane;2-methyladamantane?
The InChIKey is XKQHYINZYMKUTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18.C3H8O/c1-7-10-3-8-2-9(5-10)6-11(7)4-8;1-3-4-2/h7-11H,2-6H2,1H3;3H2,1-2H3.
What are the key properties of methoxyethane;2-methyladamantane?
methoxyethane;2-methyladamantane has a molecular weight of 210.36 g/mol, XLogP of 3.73, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methoxyethane;2-methyladamantane is sourced from PubChem (CID 174817324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).