About ethane;2-ethyladamantane
ethane;2-ethyladamantane (PubChem CID 91302679) has the molecular formula C18H38
and a molecular weight of 254.50 g/mol. Its IUPAC name is ethane;2-ethyladamantane.
Molecular Properties
| Compound Name | ethane;2-ethyladamantane |
| PubChem CID | 91302679 |
| Molecular Formula | C18H38 |
| Molecular Weight | 254.50 g/mol |
| Exact Mass | 254.30 |
| IUPAC Name | ethane;2-ethyladamantane |
| SMILES | CC.CC.CC.CCC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C12H20.3C2H6/c1-2-12-10-4-8-3-9(6-10)7-11(12)5-8;3*1-2/h8-12H,2-7H2,1H3;3*1-2H3 |
| InChIKey | WLUPGMWDVQBQSC-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 254.50 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;2-ethyladamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-ethyladamantane?
The IUPAC name of ethane;2-ethyladamantane (CID 91302679) is ethane;2-ethyladamantane.
What is the SMILES notation for ethane;2-ethyladamantane?
The canonical SMILES for ethane;2-ethyladamantane is CC.CC.CC.CCC1C2CC3CC(C2)CC1C3.
What is the InChIKey of ethane;2-ethyladamantane?
The InChIKey is WLUPGMWDVQBQSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20.3C2H6/c1-2-12-10-4-8-3-9(6-10)7-11(12)5-8;3*1-2/h8-12H,2-7H2,1H3;3*1-2H3.
What are the key properties of ethane;2-ethyladamantane?
ethane;2-ethyladamantane has a molecular weight of 254.50 g/mol, XLogP of 6.55, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-ethyladamantane is sourced from PubChem (CID 91302679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).