About adamantane;hexane
adamantane;hexane (PubChem CID 157109132) has the molecular formula C16H30
and a molecular weight of 222.42 g/mol. Its IUPAC name is adamantane;hexane.
Molecular Properties
| Compound Name | adamantane;hexane |
| PubChem CID | 157109132 |
| Molecular Formula | C16H30 |
| Molecular Weight | 222.42 g/mol |
| Exact Mass | 222.23 |
| IUPAC Name | adamantane;hexane |
| SMILES | C1C2CC3CC1CC(C2)C3.CCCCCC |
| InChI | InChI=1S/C10H16.C6H14/c1-7-2-9-4-8(1)5-10(3-7)6-9;1-3-5-6-4-2/h7-10H,1-6H2;3-6H2,1-2H3 |
| InChIKey | AGQIOAXWMRGXCR-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 222.42 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze adamantane;hexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of adamantane;hexane?
The IUPAC name of adamantane;hexane (CID 157109132) is adamantane;hexane.
What is the SMILES notation for adamantane;hexane?
The canonical SMILES for adamantane;hexane is C1C2CC3CC1CC(C2)C3.CCCCCC.
What is the InChIKey of adamantane;hexane?
The InChIKey is AGQIOAXWMRGXCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16.C6H14/c1-7-2-9-4-8(1)5-10(3-7)6-9;1-3-5-6-4-2/h7-10H,1-6H2;3-6H2,1-2H3.
What are the key properties of adamantane;hexane?
adamantane;hexane has a molecular weight of 222.42 g/mol, XLogP of 5.42, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for adamantane;hexane is sourced from PubChem (CID 157109132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).