About bicyclo[2.2.1]heptane;heptane
bicyclo[2.2.1]heptane;heptane (PubChem CID 161465006) has the molecular formula C14H28
and a molecular weight of 196.38 g/mol. Its IUPAC name is bicyclo[2.2.1]heptane;heptane.
Molecular Properties
| Compound Name | bicyclo[2.2.1]heptane;heptane |
| PubChem CID | 161465006 |
| Molecular Formula | C14H28 |
| Molecular Weight | 196.38 g/mol |
| Exact Mass | 196.22 |
| IUPAC Name | bicyclo[2.2.1]heptane;heptane |
| SMILES | C1CC2CCC1C2.CCCCCCC |
| InChI | InChI=1S/C7H12.C7H16/c1-2-7-4-3-6(1)5-7;1-3-5-7-6-4-2/h6-7H,1-5H2;3-7H2,1-2H3 |
| InChIKey | WCHRLYYAXSMZLG-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 196.38 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[2.2.1]heptane;heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.2.1]heptane;heptane?
The IUPAC name of bicyclo[2.2.1]heptane;heptane (CID 161465006) is bicyclo[2.2.1]heptane;heptane.
What is the SMILES notation for bicyclo[2.2.1]heptane;heptane?
The canonical SMILES for bicyclo[2.2.1]heptane;heptane is C1CC2CCC1C2.CCCCCCC.
What is the InChIKey of bicyclo[2.2.1]heptane;heptane?
The InChIKey is WCHRLYYAXSMZLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12.C7H16/c1-2-7-4-3-6(1)5-7;1-3-5-7-6-4-2/h6-7H,1-5H2;3-7H2,1-2H3.
What are the key properties of bicyclo[2.2.1]heptane;heptane?
bicyclo[2.2.1]heptane;heptane has a molecular weight of 196.38 g/mol, XLogP of 5.17, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.1]heptane;heptane is sourced from PubChem (CID 161465006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).