C13H22S — CID 146233668
(3S)-9-methyl-4-thiatricyclo[6.2.2.13,6]tridecane (PubChem CID 146233668) has the molecular formula C13H22S and a molecular weight of 210.39 g/mol. Its IUPAC name is (3S)-9-methyl-4-thiatricyclo[6.2.2.13,6]tridecane.
| Compound Name | (3S)-9-methyl-4-thiatricyclo[6.2.2.13,6]tridecane |
|---|---|
| PubChem CID | 146233668 |
| Molecular Formula | C13H22S |
| Molecular Weight | 210.39 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | (3S)-9-methyl-4-thiatricyclo[6.2.2.13,6]tridecane |
| SMILES | CC1CC2CCC1CC1CS[C@@H](C2)C1 |
| InChI | InChI=1S/C13H22S/c1-9-4-10-2-3-12(9)5-11-7-13(6-10)14-8-11/h9-13H,2-8H2,1H3/t9?,10?,11?,12?,13-/m0/s1 |
| InChIKey | GQSRHPFAXWTGGT-XHFUNPKLSA-N |
| XLogP | 3.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.39 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |