C11H18S — CID 146416671
(1S,6R)-4-methyl-5-thiatricyclo[4.4.1.03,8]undecane (PubChem CID 146416671) has the molecular formula C11H18S and a molecular weight of 182.33 g/mol. Its IUPAC name is (1S,6R)-4-methyl-5-thiatricyclo[4.4.1.03,8]undecane.
| Compound Name | (1S,6R)-4-methyl-5-thiatricyclo[4.4.1.03,8]undecane |
|---|---|
| PubChem CID | 146416671 |
| Molecular Formula | C11H18S |
| Molecular Weight | 182.33 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | (1S,6R)-4-methyl-5-thiatricyclo[4.4.1.03,8]undecane |
| SMILES | CC1S[C@H]2CC3CC[C@@H](CC31)C2 |
| InChI | InChI=1S/C11H18S/c1-7-11-5-8-2-3-9(11)6-10(4-8)12-7/h7-11H,2-6H2,1H3/t7?,8-,9?,10-,11?/m1/s1 |
| InChIKey | AAEABYHSRUGAPM-WYOMHHLLSA-N |
| XLogP | 3.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.33 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |