C13H23N — CID 167045827
2-(9-tricyclo[4.3.1.03,8]decanyl)propan-2-amine (PubChem CID 167045827) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is 2-(9-tricyclo[4.3.1.03,8]decanyl)propan-2-amine.
| Compound Name | 2-(9-tricyclo[4.3.1.03,8]decanyl)propan-2-amine |
|---|---|
| PubChem CID | 167045827 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | 2-(9-tricyclo[4.3.1.03,8]decanyl)propan-2-amine |
| SMILES | CC(C)(N)C1C2CC3CCC(C2)C1C3 |
| InChI | InChI=1S/C13H23N/c1-13(2,14)12-10-5-8-3-4-9(7-10)11(12)6-8/h8-12H,3-7,14H2,1-2H3 |
| InChIKey | MLHKUGPDGOFFJF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |