C15H26O — CID 124775126
(1S,2S,4R,6S)-2-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-4,6-dimethylcyclohexan-1-ol (PubChem CID 124775126) has the molecular formula C15H26O and a molecular weight of 222.37 g/mol. Its IUPAC name is (1S,2S,4R,6S)-2-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-4,6-dimethylcyclohexan-1-ol.
| Compound Name | (1S,2S,4R,6S)-2-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-4,6-dimethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 124775126 |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.37 g/mol |
| Exact Mass | 222.20 |
| IUPAC Name | (1S,2S,4R,6S)-2-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-4,6-dimethylcyclohexan-1-ol |
| SMILES | C[C@H]1C[C@@H]([C@H]2C[C@H]3CC[C@H]2C3)[C@@H](O)[C@@H](C)C1 |
| InChI | InChI=1S/C15H26O/c1-9-5-10(2)15(16)14(6-9)13-8-11-3-4-12(13)7-11/h9-16H,3-8H2,1-2H3/t9-,10+,11+,12+,13+,14+,15+/m1/s1 |
| InChIKey | WXWPEVYZHHMRRH-OAXDCTPSSA-N |
| XLogP | 3.47 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.37 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |