C17H33N3 — CID 177178858
7,9-dimethyl-1,6,12-triazatricyclo[10.2.2.23,6]octadecane (PubChem CID 177178858) has the molecular formula C17H33N3 and a molecular weight of 279.47 g/mol. Its IUPAC name is 7,9-dimethyl-1,6,12-triazatricyclo[10.2.2.23,6]octadecane.
| Compound Name | 7,9-dimethyl-1,6,12-triazatricyclo[10.2.2.23,6]octadecane |
|---|---|
| PubChem CID | 177178858 |
| Molecular Formula | C17H33N3 |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.27 |
| IUPAC Name | 7,9-dimethyl-1,6,12-triazatricyclo[10.2.2.23,6]octadecane |
| SMILES | CC1CCN2CCN(CC2)CC2CCN(CC2)C(C)C1 |
| InChI | InChI=1S/C17H33N3/c1-15-3-6-18-9-11-19(12-10-18)14-17-4-7-20(8-5-17)16(2)13-15/h15-17H,3-14H2,1-2H3 |
| InChIKey | HAWGRGLQBZFUOT-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |