About 1-azabicyclo[2.2.2]octane;prop-2-enoic acid
1-azabicyclo[2.2.2]octane;prop-2-enoic acid (PubChem CID 126596403) has the molecular formula C10H17NO2
and a molecular weight of 183.25 g/mol. Its IUPAC name is 1-azabicyclo[2.2.2]octane;prop-2-enoic acid.
Molecular Properties
| Compound Name | 1-azabicyclo[2.2.2]octane;prop-2-enoic acid |
| PubChem CID | 126596403 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 1-azabicyclo[2.2.2]octane;prop-2-enoic acid |
| SMILES | C1CN2CCC1CC2.C=CC(=O)O |
| InChI | InChI=1S/C7H13N.C3H4O2/c1-4-8-5-2-7(1)3-6-8;1-2-3(4)5/h7H,1-6H2;2H,1H2,(H,4,5) |
| InChIKey | WGOBEWKJHHGUQX-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-azabicyclo[2.2.2]octane;prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azabicyclo[2.2.2]octane;prop-2-enoic acid?
The IUPAC name of 1-azabicyclo[2.2.2]octane;prop-2-enoic acid (CID 126596403) is 1-azabicyclo[2.2.2]octane;prop-2-enoic acid.
What is the SMILES notation for 1-azabicyclo[2.2.2]octane;prop-2-enoic acid?
The canonical SMILES for 1-azabicyclo[2.2.2]octane;prop-2-enoic acid is C1CN2CCC1CC2.C=CC(=O)O.
What is the InChIKey of 1-azabicyclo[2.2.2]octane;prop-2-enoic acid?
The InChIKey is WGOBEWKJHHGUQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N.C3H4O2/c1-4-8-5-2-7(1)3-6-8;1-2-3(4)5/h7H,1-6H2;2H,1H2,(H,4,5).
What are the key properties of 1-azabicyclo[2.2.2]octane;prop-2-enoic acid?
1-azabicyclo[2.2.2]octane;prop-2-enoic acid has a molecular weight of 183.25 g/mol, XLogP of 1.36, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azabicyclo[2.2.2]octane;prop-2-enoic acid is sourced from PubChem (CID 126596403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).