C7H12O4 — CID 134965328
2,2-dihydroperoxybicyclo[2.2.1]heptane (PubChem CID 134965328) has the molecular formula C7H12O4 and a molecular weight of 160.17 g/mol. Its IUPAC name is 2,2-dihydroperoxybicyclo[2.2.1]heptane.
| Compound Name | 2,2-dihydroperoxybicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 134965328 |
| Molecular Formula | C7H12O4 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | 2,2-dihydroperoxybicyclo[2.2.1]heptane |
| SMILES | OOC1(OO)CC2CCC1C2 |
| InChI | InChI=1S/C7H12O4/c8-10-7(11-9)4-5-1-2-6(7)3-5/h5-6,8-9H,1-4H2 |
| InChIKey | WVGMRJSABKGXDT-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|