C38H56N2O2 — CID 171722197
N-[3-(adamantane-1-carbonylamino)-5-(1-adamantyl)cyclohexyl]adamantane-1-carboxamide (PubChem CID 171722197) has the molecular formula C38H56N2O2 and a molecular weight of 572.88 g/mol. Its IUPAC name is N-[3-(adamantane-1-carbonylamino)-5-(1-adamantyl)cyclohexyl]adamantane-1-carboxamide.
| Compound Name | N-[3-(adamantane-1-carbonylamino)-5-(1-adamantyl)cyclohexyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 171722197 |
| Molecular Formula | C38H56N2O2 |
| Molecular Weight | 572.88 g/mol |
| Exact Mass | 572.43 |
| IUPAC Name | N-[3-(adamantane-1-carbonylamino)-5-(1-adamantyl)cyclohexyl]adamantane-1-carboxamide |
| SMILES | O=C(NC1CC(NC(=O)C23CC4CC(CC(C4)C2)C3)CC(C23CC4CC(CC(C4)C2)C3)C1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C38H56N2O2/c41-34(37-16-25-4-26(17-37)6-27(5-25)18-37)39-32-10-31(36-13-22-1-23(14-36)3-24(2-22)15-36)11-33(12-32)40-35(42)38-19-28-7-29(20-38)9-30(8-28)21-38/h22-33H,1-21H2,(H,39,41)(H,40,42) |
| InChIKey | ICXZMKCVYSTYHR-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.88 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |