C30H40N2O2 — CID 171577222
N-[(1E,4Z,7E)-8-(adamantane-1-carbonylamino)cycloocta-1,4,7-trien-1-yl]adamantane-1-carboxamide (PubChem CID 171577222) has the molecular formula C30H40N2O2 and a molecular weight of 460.66 g/mol. Its IUPAC name is N-[(1E,4Z,7E)-8-(adamantane-1-carbonylamino)cycloocta-1,4,7-trien-1-yl]adamantane-1-carboxamide.
| Compound Name | N-[(1E,4Z,7E)-8-(adamantane-1-carbonylamino)cycloocta-1,4,7-trien-1-yl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 171577222 |
| Molecular Formula | C30H40N2O2 |
| Molecular Weight | 460.66 g/mol |
| Exact Mass | 460.31 |
| IUPAC Name | N-[(1E,4Z,7E)-8-(adamantane-1-carbonylamino)cycloocta-1,4,7-trien-1-yl]adamantane-1-carboxamide |
| SMILES | O=C(NC1=C/C/C=C\C/C=C\1NC(=O)C12CC3CC(CC(C3)C1)C2)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C30H40N2O2/c33-27(29-13-19-7-20(14-29)9-21(8-19)15-29)31-25-5-3-1-2-4-6-26(25)32-28(34)30-16-22-10-23(17-30)12-24(11-22)18-30/h1-2,5-6,19-24H,3-4,7-18H2,(H,31,33)(H,32,34)/b2-1-,25-5+,26-6+ |
| InChIKey | FFLDKDGHYKGFPB-XVQFDXLXSA-N |
| XLogP | 5.77 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.66 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|