C28H38N2O2 — CID 171722544
N-[3-(adamantane-1-carbonylamino)cyclohexa-2,5-dien-1-yl]adamantane-1-carboxamide (PubChem CID 171722544) has the molecular formula C28H38N2O2 and a molecular weight of 434.62 g/mol. Its IUPAC name is N-[3-(adamantane-1-carbonylamino)cyclohexa-2,5-dien-1-yl]adamantane-1-carboxamide.
| Compound Name | N-[3-(adamantane-1-carbonylamino)cyclohexa-2,5-dien-1-yl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 171722544 |
| Molecular Formula | C28H38N2O2 |
| Molecular Weight | 434.62 g/mol |
| Exact Mass | 434.29 |
| IUPAC Name | N-[3-(adamantane-1-carbonylamino)cyclohexa-2,5-dien-1-yl]adamantane-1-carboxamide |
| SMILES | O=C(NC1=CC(NC(=O)C23CC4CC(CC(C4)C2)C3)C=CC1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C28H38N2O2/c31-25(27-11-17-4-18(12-27)6-19(5-17)13-27)29-23-2-1-3-24(10-23)30-26(32)28-14-20-7-21(15-28)9-22(8-20)16-28/h1-2,10,17-23H,3-9,11-16H2,(H,29,31)(H,30,32) |
| InChIKey | ZVZGQSZFUOTMJN-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.62 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|