C28H41FN2O2 — CID 171722471
N-[3-(adamantane-1-carbonylamino)-5-fluorocyclohexyl]adamantane-1-carboxamide (PubChem CID 171722471) has the molecular formula C28H41FN2O2 and a molecular weight of 456.65 g/mol. Its IUPAC name is N-[3-(adamantane-1-carbonylamino)-5-fluorocyclohexyl]adamantane-1-carboxamide.
| Compound Name | N-[3-(adamantane-1-carbonylamino)-5-fluorocyclohexyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 171722471 |
| Molecular Formula | C28H41FN2O2 |
| Molecular Weight | 456.65 g/mol |
| Exact Mass | 456.32 |
| IUPAC Name | N-[3-(adamantane-1-carbonylamino)-5-fluorocyclohexyl]adamantane-1-carboxamide |
| SMILES | O=C(NC1CC(F)CC(NC(=O)C23CC4CC(CC(C4)C2)C3)C1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C28H41FN2O2/c29-22-7-23(30-25(32)27-10-16-1-17(11-27)3-18(2-16)12-27)9-24(8-22)31-26(33)28-13-19-4-20(14-28)6-21(5-19)15-28/h16-24H,1-15H2,(H,30,32)(H,31,33) |
| InChIKey | DOXXSXOZKOWYHU-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.65 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |