C17H28O — CID 125470602
(1R,2R,4S)-4-(1-adamantyl)-2-methylcyclohexan-1-ol (PubChem CID 125470602) has the molecular formula C17H28O and a molecular weight of 248.41 g/mol. Its IUPAC name is (1R,2R,4S)-4-(1-adamantyl)-2-methylcyclohexan-1-ol.
| Compound Name | (1R,2R,4S)-4-(1-adamantyl)-2-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 125470602 |
| Molecular Formula | C17H28O |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.21 |
| IUPAC Name | (1R,2R,4S)-4-(1-adamantyl)-2-methylcyclohexan-1-ol |
| SMILES | C[C@@H]1C[C@@H](C23CC4CC(CC(C4)C2)C3)CC[C@H]1O |
| InChI | InChI=1S/C17H28O/c1-11-4-15(2-3-16(11)18)17-8-12-5-13(9-17)7-14(6-12)10-17/h11-16,18H,2-10H2,1H3/t11-,12?,13?,14?,15+,16-,17?/m1/s1 |
| InChIKey | FKXPADDIDMJHJK-QSWJXUFGSA-N |
| XLogP | 4.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |