C20H26F2 — CID 10852063
(3S,5R)-1-fluoro-4-[(1R,3S)-5-fluoro-2-adamantylidene]adamantane (PubChem CID 10852063) has the molecular formula C20H26F2 and a molecular weight of 304.42 g/mol. Its IUPAC name is (3S,5R)-1-fluoro-4-[(1R,3S)-5-fluoro-2-adamantylidene]adamantane.
| Compound Name | (3S,5R)-1-fluoro-4-[(1R,3S)-5-fluoro-2-adamantylidene]adamantane |
|---|---|
| PubChem CID | 10852063 |
| Molecular Formula | C20H26F2 |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | (3S,5R)-1-fluoro-4-[(1R,3S)-5-fluoro-2-adamantylidene]adamantane |
| SMILES | FC12CC3C[C@H](C1)/C(=C1/[C@@H]4CC5C[C@H]1CC(F)(C5)C4)[C@@H](C3)C2 |
| InChI | InChI=1S/C20H26F2/c21-19-5-11-1-13(7-19)17(14(2-11)8-19)18-15-3-12-4-16(18)10-20(22,6-12)9-15/h11-16H,1-10H2/b18-17-/t11?,12?,13-,14+,15+,16-,19?,20? |
| InChIKey | UQMNLHFYBDZFRU-UOSCICOQSA-N |
| XLogP | 5.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|