C12H17FO — CID 10081394
2-[(1R,3S)-5-fluoro-2-adamantylidene]ethanol (PubChem CID 10081394) has the molecular formula C12H17FO and a molecular weight of 196.26 g/mol. Its IUPAC name is 2-[(1R,3S)-5-fluoro-2-adamantylidene]ethanol.
| Compound Name | 2-[(1R,3S)-5-fluoro-2-adamantylidene]ethanol |
|---|---|
| PubChem CID | 10081394 |
| Molecular Formula | C12H17FO |
| Molecular Weight | 196.26 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 2-[(1R,3S)-5-fluoro-2-adamantylidene]ethanol |
| SMILES | OC/C=C1\[C@@H]2CC3C[C@H]1CC(F)(C3)C2 |
| InChI | InChI=1S/C12H17FO/c13-12-5-8-3-9(6-12)11(1-2-14)10(4-8)7-12/h1,8-10,14H,2-7H2/b11-1-/t8?,9-,10+,12?/m0/s1 |
| InChIKey | PLTNZDJWTAWKDZ-PQVUUMGISA-N |
| XLogP | 2.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.26 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|