About 2-(2-hydroxyethylidene)cyclohexane-1,3-diol
2-(2-hydroxyethylidene)cyclohexane-1,3-diol (PubChem CID 130127302) has the molecular formula C8H14O3
and a molecular weight of 158.20 g/mol. Its IUPAC name is 2-(2-hydroxyethylidene)cyclohexane-1,3-diol.
Molecular Properties
| Compound Name | 2-(2-hydroxyethylidene)cyclohexane-1,3-diol |
| PubChem CID | 130127302 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | 2-(2-hydroxyethylidene)cyclohexane-1,3-diol |
| SMILES | OCC=C1C(O)CCCC1O |
| InChI | InChI=1S/C8H14O3/c9-5-4-6-7(10)2-1-3-8(6)11/h4,7-11H,1-3,5H2 |
| InChIKey | NYUGZBWHVGYOMN-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-hydroxyethylidene)cyclohexane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-hydroxyethylidene)cyclohexane-1,3-diol?
The IUPAC name of 2-(2-hydroxyethylidene)cyclohexane-1,3-diol (CID 130127302) is 2-(2-hydroxyethylidene)cyclohexane-1,3-diol.
What is the SMILES notation for 2-(2-hydroxyethylidene)cyclohexane-1,3-diol?
The canonical SMILES for 2-(2-hydroxyethylidene)cyclohexane-1,3-diol is OCC=C1C(O)CCCC1O.
What is the InChIKey of 2-(2-hydroxyethylidene)cyclohexane-1,3-diol?
The InChIKey is NYUGZBWHVGYOMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O3/c9-5-4-6-7(10)2-1-3-8(6)11/h4,7-11H,1-3,5H2.
What are the key properties of 2-(2-hydroxyethylidene)cyclohexane-1,3-diol?
2-(2-hydroxyethylidene)cyclohexane-1,3-diol has a molecular weight of 158.20 g/mol, XLogP of -0.19, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-hydroxyethylidene)cyclohexane-1,3-diol is sourced from PubChem (CID 130127302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).