About (1S,5R)-3-fluorotricyclo[3.3.1.03,7]nonan-9-one
(1S,5R)-3-fluorotricyclo[3.3.1.03,7]nonan-9-one (PubChem CID 10654444) has the molecular formula C9H11FO
and a molecular weight of 154.18 g/mol. Its IUPAC name is (1S,5R)-3-fluorotricyclo[3.3.1.03,7]nonan-9-one.
Molecular Properties
| Compound Name | (1S,5R)-3-fluorotricyclo[3.3.1.03,7]nonan-9-one |
| PubChem CID | 10654444 |
| Molecular Formula | C9H11FO |
| Molecular Weight | 154.18 g/mol |
| Exact Mass | 154.08 |
| IUPAC Name | (1S,5R)-3-fluorotricyclo[3.3.1.03,7]nonan-9-one |
| SMILES | O=C1[C@@H]2CC3C[C@H]1CC3(F)C2 |
| InChI | InChI=1S/C9H11FO/c10-9-3-5-1-7(9)2-6(4-9)8(5)11/h5-7H,1-4H2/t5-,6+,7?,9? |
| InChIKey | FVEVRESQRWANEP-YJYOEFFTSA-N |
| XLogP | 1.71 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.18 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1S,5R)-3-fluorotricyclo[3.3.1.03,7]nonan-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,5R)-3-fluorotricyclo[3.3.1.03,7]nonan-9-one?
The IUPAC name of (1S,5R)-3-fluorotricyclo[3.3.1.03,7]nonan-9-one (CID 10654444) is (1S,5R)-3-fluorotricyclo[3.3.1.03,7]nonan-9-one.
What is the SMILES notation for (1S,5R)-3-fluorotricyclo[3.3.1.03,7]nonan-9-one?
The canonical SMILES for (1S,5R)-3-fluorotricyclo[3.3.1.03,7]nonan-9-one is O=C1[C@@H]2CC3C[C@H]1CC3(F)C2.
What is the InChIKey of (1S,5R)-3-fluorotricyclo[3.3.1.03,7]nonan-9-one?
The InChIKey is FVEVRESQRWANEP-YJYOEFFTSA-N. The full InChI is InChI=1S/C9H11FO/c10-9-3-5-1-7(9)2-6(4-9)8(5)11/h5-7H,1-4H2/t5-,6+,7?,9?.
What are the key properties of (1S,5R)-3-fluorotricyclo[3.3.1.03,7]nonan-9-one?
(1S,5R)-3-fluorotricyclo[3.3.1.03,7]nonan-9-one has a molecular weight of 154.18 g/mol, XLogP of 1.71, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,5R)-3-fluorotricyclo[3.3.1.03,7]nonan-9-one is sourced from PubChem (CID 10654444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).