About (1R,3R,5R,7R)-3-methyl-2-oxatricyclo[3.3.1.03,7]nonan-9-one
(1R,3R,5R,7R)-3-methyl-2-oxatricyclo[3.3.1.03,7]nonan-9-one (PubChem CID 10701998) has the molecular formula C9H12O2
and a molecular weight of 152.19 g/mol. Its IUPAC name is (1R,3R,5R,7R)-3-methyl-2-oxatricyclo[3.3.1.03,7]nonan-9-one.
Analyze (1R,3R,5R,7R)-3-methyl-2-oxatricyclo[3.3.1.03,7]nonan-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,3R,5R,7R)-3-methyl-2-oxatricyclo[3.3.1.03,7]nonan-9-one?
The IUPAC name of (1R,3R,5R,7R)-3-methyl-2-oxatricyclo[3.3.1.03,7]nonan-9-one (CID 10701998) is (1R,3R,5R,7R)-3-methyl-2-oxatricyclo[3.3.1.03,7]nonan-9-one.
What is the SMILES notation for (1R,3R,5R,7R)-3-methyl-2-oxatricyclo[3.3.1.03,7]nonan-9-one?
The canonical SMILES for (1R,3R,5R,7R)-3-methyl-2-oxatricyclo[3.3.1.03,7]nonan-9-one is C[C@@]12C[C@H]3C[C@@H]1C[C@@H](O2)C3=O.
What is the InChIKey of (1R,3R,5R,7R)-3-methyl-2-oxatricyclo[3.3.1.03,7]nonan-9-one?
The InChIKey is LIPKRICEQJDWHK-JXOAFFINSA-N. The full InChI is InChI=1S/C9H12O2/c1-9-4-5-2-6(9)3-7(11-9)8(5)10/h5-7H,2-4H2,1H3/t5-,6-,7-,9-/m1/s1.
What are the key properties of (1R,3R,5R,7R)-3-methyl-2-oxatricyclo[3.3.1.03,7]nonan-9-one?
(1R,3R,5R,7R)-3-methyl-2-oxatricyclo[3.3.1.03,7]nonan-9-one has a molecular weight of 152.19 g/mol, XLogP of 1.14, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,3R,5R,7R)-3-methyl-2-oxatricyclo[3.3.1.03,7]nonan-9-one is sourced from PubChem (CID 10701998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).