C11H15BrO3 — CID 100979873
(1S,3R,4R,6S,8S)-4-bromo-3-ethoxy-2-oxatricyclo[4.3.1.03,8]decan-10-one (PubChem CID 100979873) has the molecular formula C11H15BrO3 and a molecular weight of 275.14 g/mol. Its IUPAC name is (1S,3R,4R,6S,8S)-4-bromo-3-ethoxy-2-oxatricyclo[4.3.1.03,8]decan-10-one.
| Compound Name | (1S,3R,4R,6S,8S)-4-bromo-3-ethoxy-2-oxatricyclo[4.3.1.03,8]decan-10-one |
|---|---|
| PubChem CID | 100979873 |
| Molecular Formula | C11H15BrO3 |
| Molecular Weight | 275.14 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | (1S,3R,4R,6S,8S)-4-bromo-3-ethoxy-2-oxatricyclo[4.3.1.03,8]decan-10-one |
| SMILES | CCO[C@@]12O[C@H]3C[C@@H]1C[C@@H](C[C@H]2Br)C3=O |
| InChI | InChI=1S/C11H15BrO3/c1-2-14-11-7-3-6(4-9(11)12)10(13)8(5-7)15-11/h6-9H,2-5H2,1H3/t6-,7-,8-,9+,11+/m0/s1 |
| InChIKey | CJVLDRKQZTYNCN-HTFKAIDBSA-N |
| XLogP | 1.88 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.14 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|