C10H13ClO3 — CID 100979872
(1S,3R,4R,6S,8S)-4-chloro-3-methoxy-2-oxatricyclo[4.3.1.03,8]decan-10-one (PubChem CID 100979872) has the molecular formula C10H13ClO3 and a molecular weight of 216.66 g/mol. Its IUPAC name is (1S,3R,4R,6S,8S)-4-chloro-3-methoxy-2-oxatricyclo[4.3.1.03,8]decan-10-one.
| Compound Name | (1S,3R,4R,6S,8S)-4-chloro-3-methoxy-2-oxatricyclo[4.3.1.03,8]decan-10-one |
|---|---|
| PubChem CID | 100979872 |
| Molecular Formula | C10H13ClO3 |
| Molecular Weight | 216.66 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | (1S,3R,4R,6S,8S)-4-chloro-3-methoxy-2-oxatricyclo[4.3.1.03,8]decan-10-one |
| SMILES | CO[C@@]12O[C@H]3C[C@@H]1C[C@@H](C[C@H]2Cl)C3=O |
| InChI | InChI=1S/C10H13ClO3/c1-13-10-6-2-5(3-8(10)11)9(12)7(4-6)14-10/h5-8H,2-4H2,1H3/t5-,6-,7-,8+,10+/m0/s1 |
| InChIKey | KNVPLUOFMLAPEU-UFNQKSLJSA-N |
| XLogP | 1.33 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.66 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|