C11H12Cl2O5 — CID 12989970
(1S,2R,6S,7R)-1,7-dichloro-10,10-dimethoxy-4-oxatricyclo[5.2.1.02,6]decane-8,9-dione (PubChem CID 12989970) has the molecular formula C11H12Cl2O5 and a molecular weight of 295.12 g/mol. Its IUPAC name is (1S,2R,6S,7R)-1,7-dichloro-10,10-dimethoxy-4-oxatricyclo[5.2.1.02,6]decane-8,9-dione.
| Compound Name | (1S,2R,6S,7R)-1,7-dichloro-10,10-dimethoxy-4-oxatricyclo[5.2.1.02,6]decane-8,9-dione |
|---|---|
| PubChem CID | 12989970 |
| Molecular Formula | C11H12Cl2O5 |
| Molecular Weight | 295.12 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | (1S,2R,6S,7R)-1,7-dichloro-10,10-dimethoxy-4-oxatricyclo[5.2.1.02,6]decane-8,9-dione |
| SMILES | COC1(OC)[C@@]2(Cl)C(=O)C(=O)[C@]1(Cl)[C@@H]1COC[C@@H]12 |
| InChI | InChI=1S/C11H12Cl2O5/c1-16-11(17-2)9(12)5-3-18-4-6(5)10(11,13)8(15)7(9)14/h5-6H,3-4H2,1-2H3/t5-,6+,9-,10+ |
| InChIKey | JONUWZKSHDJBOF-YUMGAWCOSA-N |
| XLogP | 0.36 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.12 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|