C11H12Cl2O6 — CID 101081163
(1R,2S,3R,6R,8S,10S)-1,10-dichloro-8-hydroxy-11,11-dimethoxy-5,7-dioxatetracyclo[6.3.0.02,6.03,10]undecan-9-one (PubChem CID 101081163) has the molecular formula C11H12Cl2O6 and a molecular weight of 311.12 g/mol. Its IUPAC name is (1R,2S,3R,6R,8S,10S)-1,10-dichloro-8-hydroxy-11,11-dimethoxy-5,7-dioxatetracyclo[6.3.0.02,6.03,10]undecan-9-one.
| Compound Name | (1R,2S,3R,6R,8S,10S)-1,10-dichloro-8-hydroxy-11,11-dimethoxy-5,7-dioxatetracyclo[6.3.0.02,6.03,10]undecan-9-one |
|---|---|
| PubChem CID | 101081163 |
| Molecular Formula | C11H12Cl2O6 |
| Molecular Weight | 311.12 g/mol |
| Exact Mass | 310.00 |
| IUPAC Name | (1R,2S,3R,6R,8S,10S)-1,10-dichloro-8-hydroxy-11,11-dimethoxy-5,7-dioxatetracyclo[6.3.0.02,6.03,10]undecan-9-one |
| SMILES | COC1(OC)[C@@]2(Cl)C(=O)[C@]3(O)O[C@H]4OC[C@H]2[C@@H]4[C@]13Cl |
| InChI | InChI=1S/C11H12Cl2O6/c1-16-11(17-2)8(12)4-3-18-6-5(4)9(11,13)10(15,19-6)7(8)14/h4-6,15H,3H2,1-2H3/t4-,5-,6+,8-,9+,10-/m0/s1 |
| InChIKey | MYYRAGXYTQNDIJ-GMDSZBONSA-N |
| XLogP | -0.17 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.12 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|