C15H20Cl2O4 — CID 11232930
(1S,2S,6R,7R,9R)-1,7-dichloro-9-hydroxy-10,10-dimethoxy-9-prop-2-enyltricyclo[5.2.1.02,6]decan-8-one (PubChem CID 11232930) has the molecular formula C15H20Cl2O4 and a molecular weight of 335.23 g/mol. Its IUPAC name is (1S,2S,6R,7R,9R)-1,7-dichloro-9-hydroxy-10,10-dimethoxy-9-prop-2-enyltricyclo[5.2.1.02,6]decan-8-one.
| Compound Name | (1S,2S,6R,7R,9R)-1,7-dichloro-9-hydroxy-10,10-dimethoxy-9-prop-2-enyltricyclo[5.2.1.02,6]decan-8-one |
|---|---|
| PubChem CID | 11232930 |
| Molecular Formula | C15H20Cl2O4 |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | (1S,2S,6R,7R,9R)-1,7-dichloro-9-hydroxy-10,10-dimethoxy-9-prop-2-enyltricyclo[5.2.1.02,6]decan-8-one |
| SMILES | C=CC[C@@]1(O)C(=O)[C@]2(Cl)[C@@H]3CCC[C@@H]3[C@@]1(Cl)C2(OC)OC |
| InChI | InChI=1S/C15H20Cl2O4/c1-4-8-12(19)11(18)13(16)9-6-5-7-10(9)14(12,17)15(13,20-2)21-3/h4,9-10,19H,1,5-8H2,2-3H3/t9-,10+,12-,13-,14+/m1/s1 |
| InChIKey | PNRPEBOSGLINLZ-ZJMQZLNVSA-N |
| XLogP | 2.25 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|