C15H20Cl2O6 — CID 11428580
[(1R,2S,4S,5R)-1,4-dichloro-5-hydroxy-7,7-dimethoxy-6-oxo-5-prop-2-enyl-2-bicyclo[2.2.1]heptanyl]methyl acetate (PubChem CID 11428580) has the molecular formula C15H20Cl2O6 and a molecular weight of 367.23 g/mol. Its IUPAC name is [(1R,2S,4S,5R)-1,4-dichloro-5-hydroxy-7,7-dimethoxy-6-oxo-5-prop-2-enyl-2-bicyclo[2.2.1]heptanyl]methyl acetate.
| Compound Name | [(1R,2S,4S,5R)-1,4-dichloro-5-hydroxy-7,7-dimethoxy-6-oxo-5-prop-2-enyl-2-bicyclo[2.2.1]heptanyl]methyl acetate |
|---|---|
| PubChem CID | 11428580 |
| Molecular Formula | C15H20Cl2O6 |
| Molecular Weight | 367.23 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | [(1R,2S,4S,5R)-1,4-dichloro-5-hydroxy-7,7-dimethoxy-6-oxo-5-prop-2-enyl-2-bicyclo[2.2.1]heptanyl]methyl acetate |
| SMILES | C=CC[C@@]1(O)C(=O)[C@]2(Cl)[C@H](COC(C)=O)C[C@@]1(Cl)C2(OC)OC |
| InChI | InChI=1S/C15H20Cl2O6/c1-5-6-12(20)11(19)14(17)10(8-23-9(2)18)7-13(12,16)15(14,21-3)22-4/h5,10,20H,1,6-8H2,2-4H3/t10-,12+,13-,14+/m0/s1 |
| InChIKey | VSYZXFHBRHTEEI-AHLTXXRQSA-N |
| XLogP | 1.40 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.23 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|