C19H32O4 — CID 11141892
[(1S,3aS,5S,7aR)-3a-hydroxy-5-(4-hydroxycyclohexyl)-7a-methyl-2,3,4,5,6,7-hexahydro-1H-inden-1-yl]methyl acetate (PubChem CID 11141892) has the molecular formula C19H32O4 and a molecular weight of 324.46 g/mol. Its IUPAC name is [(1S,3aS,5S,7aR)-3a-hydroxy-5-(4-hydroxycyclohexyl)-7a-methyl-2,3,4,5,6,7-hexahydro-1H-inden-1-yl]methyl acetate.
| Compound Name | [(1S,3aS,5S,7aR)-3a-hydroxy-5-(4-hydroxycyclohexyl)-7a-methyl-2,3,4,5,6,7-hexahydro-1H-inden-1-yl]methyl acetate |
|---|---|
| PubChem CID | 11141892 |
| Molecular Formula | C19H32O4 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | [(1S,3aS,5S,7aR)-3a-hydroxy-5-(4-hydroxycyclohexyl)-7a-methyl-2,3,4,5,6,7-hexahydro-1H-inden-1-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1CC[C@]2(O)C[C@@H](C3CCC(O)CC3)CC[C@]12C |
| InChI | InChI=1S/C19H32O4/c1-13(20)23-12-16-8-10-19(22)11-15(7-9-18(16,19)2)14-3-5-17(21)6-4-14/h14-17,21-22H,3-12H2,1-2H3/t14?,15-,16+,17?,18+,19-/m0/s1 |
| InChIKey | QTFRWHBKFZUAHL-UJZOANHMSA-N |
| XLogP | 3.05 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |