C19H32O5 — CID 162320524
5-cyclohexyl-1,7a-dimethyl-2,3,4,5,6,7-hexahydro-1H-inden-3a-ol;oxalic acid (PubChem CID 162320524) has the molecular formula C19H32O5 and a molecular weight of 340.46 g/mol. Its IUPAC name is 5-cyclohexyl-1,7a-dimethyl-2,3,4,5,6,7-hexahydro-1H-inden-3a-ol;oxalic acid.
| Compound Name | 5-cyclohexyl-1,7a-dimethyl-2,3,4,5,6,7-hexahydro-1H-inden-3a-ol;oxalic acid |
|---|---|
| PubChem CID | 162320524 |
| Molecular Formula | C19H32O5 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | 5-cyclohexyl-1,7a-dimethyl-2,3,4,5,6,7-hexahydro-1H-inden-3a-ol;oxalic acid |
| SMILES | CC1CCC2(O)CC(C3CCCCC3)CCC12C.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H30O.C2H2O4/c1-13-8-11-17(18)12-15(9-10-16(13,17)2)14-6-4-3-5-7-14;3-1(4)2(5)6/h13-15,18H,3-12H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | GRFBOABWZKWDLW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|