C20H28O5 — CID 57141616
[(1S,3aS,5R,7aR)-3a,5-dihydroxy-5-[3-(hydroxymethyl)phenyl]-7a-methyl-1,2,3,4,6,7-hexahydroinden-1-yl]methyl acetate (PubChem CID 57141616) has the molecular formula C20H28O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is [(1S,3aS,5R,7aR)-3a,5-dihydroxy-5-[3-(hydroxymethyl)phenyl]-7a-methyl-1,2,3,4,6,7-hexahydroinden-1-yl]methyl acetate.
| Compound Name | [(1S,3aS,5R,7aR)-3a,5-dihydroxy-5-[3-(hydroxymethyl)phenyl]-7a-methyl-1,2,3,4,6,7-hexahydroinden-1-yl]methyl acetate |
|---|---|
| PubChem CID | 57141616 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | [(1S,3aS,5R,7aR)-3a,5-dihydroxy-5-[3-(hydroxymethyl)phenyl]-7a-methyl-1,2,3,4,6,7-hexahydroinden-1-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1CC[C@]2(O)C[C@@](O)(c3cccc(CO)c3)CC[C@]12C |
| InChI | InChI=1S/C20H28O5/c1-14(22)25-12-17-6-7-20(24)13-19(23,9-8-18(17,20)2)16-5-3-4-15(10-16)11-21/h3-5,10,17,21,23-24H,6-9,11-13H2,1-2H3/t17-,18-,19-,20+/m1/s1 |
| InChIKey | WRXUUVOULQKSAE-WTGUMLROSA-N |
| XLogP | 2.26 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |