C18H26Cl2O4 — CID 11474365
(1S,2S,9R,10R,12R)-1,10-dichloro-12-hydroxy-13,13-dimethoxy-12-prop-2-enyltricyclo[8.2.1.02,9]tridecan-11-one (PubChem CID 11474365) has the molecular formula C18H26Cl2O4 and a molecular weight of 377.31 g/mol. Its IUPAC name is (1S,2S,9R,10R,12R)-1,10-dichloro-12-hydroxy-13,13-dimethoxy-12-prop-2-enyltricyclo[8.2.1.02,9]tridecan-11-one.
| Compound Name | (1S,2S,9R,10R,12R)-1,10-dichloro-12-hydroxy-13,13-dimethoxy-12-prop-2-enyltricyclo[8.2.1.02,9]tridecan-11-one |
|---|---|
| PubChem CID | 11474365 |
| Molecular Formula | C18H26Cl2O4 |
| Molecular Weight | 377.31 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | (1S,2S,9R,10R,12R)-1,10-dichloro-12-hydroxy-13,13-dimethoxy-12-prop-2-enyltricyclo[8.2.1.02,9]tridecan-11-one |
| SMILES | C=CC[C@@]1(O)C(=O)[C@]2(Cl)[C@@H]3CCCCCC[C@@H]3[C@@]1(Cl)C2(OC)OC |
| InChI | InChI=1S/C18H26Cl2O4/c1-4-11-15(22)14(21)16(19)12-9-7-5-6-8-10-13(12)17(15,20)18(16,23-2)24-3/h4,12-13,22H,1,5-11H2,2-3H3/t12-,13+,15-,16-,17+/m1/s1 |
| InChIKey | PRRYUGAROFDGON-IEHFGQBSSA-N |
| XLogP | 3.42 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.31 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|