C13H16Cl2O4 — CID 12989967
(1R,2R,7S,8S)-1,8-dichloro-11,11-dimethoxytricyclo[6.2.1.02,7]undecane-9,10-dione (PubChem CID 12989967) has the molecular formula C13H16Cl2O4 and a molecular weight of 307.17 g/mol. Its IUPAC name is (1R,2R,7S,8S)-1,8-dichloro-11,11-dimethoxytricyclo[6.2.1.02,7]undecane-9,10-dione.
| Compound Name | (1R,2R,7S,8S)-1,8-dichloro-11,11-dimethoxytricyclo[6.2.1.02,7]undecane-9,10-dione |
|---|---|
| PubChem CID | 12989967 |
| Molecular Formula | C13H16Cl2O4 |
| Molecular Weight | 307.17 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | (1R,2R,7S,8S)-1,8-dichloro-11,11-dimethoxytricyclo[6.2.1.02,7]undecane-9,10-dione |
| SMILES | COC1(OC)[C@@]2(Cl)C(=O)C(=O)[C@]1(Cl)[C@@H]1CCCC[C@@H]12 |
| InChI | InChI=1S/C13H16Cl2O4/c1-18-13(19-2)11(14)7-5-3-4-6-8(7)12(13,15)10(17)9(11)16/h7-8H,3-6H2,1-2H3/t7-,8+,11-,12+ |
| InChIKey | JUBOVFCNTPKLLT-ZTCHHREXSA-N |
| XLogP | 1.90 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.17 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|