C12H18Cl2O4Si — CID 11313357
(1R,4S,5S)-1,4-dichloro-7,7-dimethoxy-5-trimethylsilylbicyclo[2.2.1]heptane-2,3-dione (PubChem CID 11313357) has the molecular formula C12H18Cl2O4Si and a molecular weight of 325.26 g/mol. Its IUPAC name is (1R,4S,5S)-1,4-dichloro-7,7-dimethoxy-5-trimethylsilylbicyclo[2.2.1]heptane-2,3-dione.
| Compound Name | (1R,4S,5S)-1,4-dichloro-7,7-dimethoxy-5-trimethylsilylbicyclo[2.2.1]heptane-2,3-dione |
|---|---|
| PubChem CID | 11313357 |
| Molecular Formula | C12H18Cl2O4Si |
| Molecular Weight | 325.26 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | (1R,4S,5S)-1,4-dichloro-7,7-dimethoxy-5-trimethylsilylbicyclo[2.2.1]heptane-2,3-dione |
| SMILES | COC1(OC)[C@@]2(Cl)C[C@H]([Si](C)(C)C)[C@]1(Cl)C(=O)C2=O |
| InChI | InChI=1S/C12H18Cl2O4Si/c1-17-12(18-2)10(13)6-7(19(3,4)5)11(12,14)9(16)8(10)15/h7H,6H2,1-5H3/t7-,10+,11-/m0/s1 |
| InChIKey | FIJQNRNWLWZPQC-XROYCOCOSA-N |
| XLogP | 2.19 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.26 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|