C17H26O3 — CID 102237673
(6aS)-2-cyclohexyl-2-methoxy-6a-prop-2-enyl-3a,4,5,6-tetrahydrocyclopenta[b]furan-3-one (PubChem CID 102237673) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is (6aS)-2-cyclohexyl-2-methoxy-6a-prop-2-enyl-3a,4,5,6-tetrahydrocyclopenta[b]furan-3-one.
| Compound Name | (6aS)-2-cyclohexyl-2-methoxy-6a-prop-2-enyl-3a,4,5,6-tetrahydrocyclopenta[b]furan-3-one |
|---|---|
| PubChem CID | 102237673 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | (6aS)-2-cyclohexyl-2-methoxy-6a-prop-2-enyl-3a,4,5,6-tetrahydrocyclopenta[b]furan-3-one |
| SMILES | C=CC[C@@]12CCCC1C(=O)C(OC)(C1CCCCC1)O2 |
| InChI | InChI=1S/C17H26O3/c1-3-11-16-12-7-10-14(16)15(18)17(19-2,20-16)13-8-5-4-6-9-13/h3,13-14H,1,4-12H2,2H3/t14?,16-,17?/m1/s1 |
| InChIKey | YBFGXWLCKRKHHW-ARWYELJZSA-N |
| XLogP | 3.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|