C13H18O2 — CID 102373505
trans-(2R,6S)-6-but-2-ynyl-2-hydroxy-2-prop-2-enylcyclohexan-1-one (PubChem CID 102373505) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is trans-(2R,6S)-6-but-2-ynyl-2-hydroxy-2-prop-2-enylcyclohexan-1-one.
| Compound Name | trans-(2R,6S)-6-but-2-ynyl-2-hydroxy-2-prop-2-enylcyclohexan-1-one |
|---|---|
| PubChem CID | 102373505 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | trans-(2R,6S)-6-but-2-ynyl-2-hydroxy-2-prop-2-enylcyclohexan-1-one |
| SMILES | C=CC[C@]1(O)CCC[C@@H](CC#CC)C1=O |
| InChI | InChI=1S/C13H18O2/c1-3-5-7-11-8-6-10-13(15,9-4-2)12(11)14/h4,11,15H,2,6-10H2,1H3/t11-,13+/m1/s1 |
| InChIKey | RPUQXPKTFLUVNL-YPMHNXCESA-N |
| XLogP | 2.08 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|