C16H24O2 — CID 102087938
(5S)-5-cyclohexyl-5-prop-2-enylcycloheptane-1,4-dione (PubChem CID 102087938) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is (5S)-5-cyclohexyl-5-prop-2-enylcycloheptane-1,4-dione.
| Compound Name | (5S)-5-cyclohexyl-5-prop-2-enylcycloheptane-1,4-dione |
|---|---|
| PubChem CID | 102087938 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | (5S)-5-cyclohexyl-5-prop-2-enylcycloheptane-1,4-dione |
| SMILES | C=CC[C@]1(C2CCCCC2)CCC(=O)CCC1=O |
| InChI | InChI=1S/C16H24O2/c1-2-11-16(13-6-4-3-5-7-13)12-10-14(17)8-9-15(16)18/h2,13H,1,3-12H2/t16-/m1/s1 |
| InChIKey | VSAZJZXMPNNHNR-MRXNPFEDSA-N |
| XLogP | 3.84 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|